C21H24N6O — CID 150026246
4,4-bis(2H-benzotriazol-4-yl)-2,3,3-trimethylhex-5-en-2-ol (PubChem CID 150026246) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 4,4-bis(2H-benzotriazol-4-yl)-2,3,3-trimethylhex-5-en-2-ol.
| Compound Name | 4,4-bis(2H-benzotriazol-4-yl)-2,3,3-trimethylhex-5-en-2-ol |
|---|---|
| PubChem CID | 150026246 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 4,4-bis(2H-benzotriazol-4-yl)-2,3,3-trimethylhex-5-en-2-ol |
| SMILES | C=CC(c1cccc2n[nH]nc12)(c1cccc2n[nH]nc12)C(C)(C)C(C)(C)O |
| InChI | InChI=1S/C21H24N6O/c1-6-21(19(2,3)20(4,5)28,13-9-7-11-15-17(13)24-26-22-15)14-10-8-12-16-18(14)25-27-23-16/h6-12,28H,1H2,2-5H3,(H,22,24,26)(H,23,25,27) |
| InChIKey | DGHQAROSQYHYAE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|