C9H14N2O2 — CID 150034002
3-(3-methylmorpholin-4-yl)-1,2-dihydropyrrol-5-one (PubChem CID 150034002) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 3-(3-methylmorpholin-4-yl)-1,2-dihydropyrrol-5-one.
| Compound Name | 3-(3-methylmorpholin-4-yl)-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 150034002 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 3-(3-methylmorpholin-4-yl)-1,2-dihydropyrrol-5-one |
| SMILES | CC1COCCN1C1=CC(=O)NC1 |
| InChI | InChI=1S/C9H14N2O2/c1-7-6-13-3-2-11(7)8-4-9(12)10-5-8/h4,7H,2-3,5-6H2,1H3,(H,10,12) |
| InChIKey | DHWGTHNUTZEJLF-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |