C27H34N2O6 — CID 150035036
1-[4-[2,4-bis(methoxymethoxy)phenyl]piperazin-1-yl]-3-naphthalen-1-yloxypropan-2-ol (PubChem CID 150035036) has the molecular formula C27H34N2O6 and a molecular weight of 482.58 g/mol. Its IUPAC name is 1-[4-[2,4-bis(methoxymethoxy)phenyl]piperazin-1-yl]-3-naphthalen-1-yloxypropan-2-ol.
| Compound Name | 1-[4-[2,4-bis(methoxymethoxy)phenyl]piperazin-1-yl]-3-naphthalen-1-yloxypropan-2-ol |
|---|---|
| PubChem CID | 150035036 |
| Molecular Formula | C27H34N2O6 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 1-[4-[2,4-bis(methoxymethoxy)phenyl]piperazin-1-yl]-3-naphthalen-1-yloxypropan-2-ol |
| SMILES | COCOc1ccc(N2CCN(CC(O)COc3cccc4ccccc34)CC2)c(OCOC)c1 |
| InChI | InChI=1S/C27H34N2O6/c1-31-19-34-23-10-11-25(27(16-23)35-20-32-2)29-14-12-28(13-15-29)17-22(30)18-33-26-9-5-7-21-6-3-4-8-24(21)26/h3-11,16,22,30H,12-15,17-20H2,1-2H3 |
| InChIKey | DIBMOXNQBRPRFP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|