C11H21N3O — CID 150039378
N-butyl-N-(1,2,4-oxadiazol-5-ylmethyl)butan-1-amine (PubChem CID 150039378) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is N-butyl-N-(1,2,4-oxadiazol-5-ylmethyl)butan-1-amine.
| Compound Name | N-butyl-N-(1,2,4-oxadiazol-5-ylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 150039378 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | N-butyl-N-(1,2,4-oxadiazol-5-ylmethyl)butan-1-amine |
| SMILES | CCCCN(CCCC)Cc1ncno1 |
| InChI | InChI=1S/C11H21N3O/c1-3-5-7-14(8-6-4-2)9-11-12-10-13-15-11/h10H,3-9H2,1-2H3 |
| InChIKey | DIYPKQKSCGTZNP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |