About diphenylphosphoryl 4-tert-butylbenzoate
diphenylphosphoryl 4-tert-butylbenzoate (PubChem CID 150039694) has the molecular formula C23H23O3P
and a molecular weight of 378.41 g/mol. Its IUPAC name is diphenylphosphoryl 4-tert-butylbenzoate.
Molecular Properties
| Compound Name | diphenylphosphoryl 4-tert-butylbenzoate |
| PubChem CID | 150039694 |
| Molecular Formula | C23H23O3P |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | diphenylphosphoryl 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)OP(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23O3P/c1-23(2,3)19-16-14-18(15-17-19)22(24)26-27(25,20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-17H,1-3H3 |
| InChIKey | DJADWDSGYIVSKU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphoryl 4-tert-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphoryl 4-tert-butylbenzoate?
The IUPAC name of diphenylphosphoryl 4-tert-butylbenzoate (CID 150039694) is diphenylphosphoryl 4-tert-butylbenzoate.
What is the SMILES notation for diphenylphosphoryl 4-tert-butylbenzoate?
The canonical SMILES for diphenylphosphoryl 4-tert-butylbenzoate is CC(C)(C)c1ccc(C(=O)OP(=O)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of diphenylphosphoryl 4-tert-butylbenzoate?
The InChIKey is DJADWDSGYIVSKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23O3P/c1-23(2,3)19-16-14-18(15-17-19)22(24)26-27(25,20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-17H,1-3H3.
What are the key properties of diphenylphosphoryl 4-tert-butylbenzoate?
diphenylphosphoryl 4-tert-butylbenzoate has a molecular weight of 378.41 g/mol, XLogP of 5.07, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphoryl 4-tert-butylbenzoate is sourced from PubChem (CID 150039694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).