About alumane;carboxy 4-tert-butylbenzoate
alumane;carboxy 4-tert-butylbenzoate (PubChem CID 174594858) has the molecular formula C12H17AlO4
and a molecular weight of 252.25 g/mol. Its IUPAC name is alumane;carboxy 4-tert-butylbenzoate.
Molecular Properties
| Compound Name | alumane;carboxy 4-tert-butylbenzoate |
| PubChem CID | 174594858 |
| Molecular Formula | C12H17AlO4 |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | alumane;carboxy 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)OC(=O)O)cc1.[AlH3] |
| InChI | InChI=1S/C12H14O4.Al.3H/c1-12(2,3)9-6-4-8(5-7-9)10(13)16-11(14)15;;;;/h4-7H,1-3H3,(H,14,15);;;; |
| InChIKey | ZBWLAMDHMNMXIV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze alumane;carboxy 4-tert-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;carboxy 4-tert-butylbenzoate?
The IUPAC name of alumane;carboxy 4-tert-butylbenzoate (CID 174594858) is alumane;carboxy 4-tert-butylbenzoate.
What is the SMILES notation for alumane;carboxy 4-tert-butylbenzoate?
The canonical SMILES for alumane;carboxy 4-tert-butylbenzoate is CC(C)(C)c1ccc(C(=O)OC(=O)O)cc1.[AlH3].
What is the InChIKey of alumane;carboxy 4-tert-butylbenzoate?
The InChIKey is ZBWLAMDHMNMXIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4.Al.3H/c1-12(2,3)9-6-4-8(5-7-9)10(13)16-11(14)15;;;;/h4-7H,1-3H3,(H,14,15);;;;.
What are the key properties of alumane;carboxy 4-tert-butylbenzoate?
alumane;carboxy 4-tert-butylbenzoate has a molecular weight of 252.25 g/mol, XLogP of 1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;carboxy 4-tert-butylbenzoate is sourced from PubChem (CID 174594858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).