C17H20O4 — CID 15004573
(3E)-3-hex-5-enylidene-5,6-dimethoxy-1,2-dihydroindene-4,7-dione (PubChem CID 15004573) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is (3E)-3-hex-5-enylidene-5,6-dimethoxy-1,2-dihydroindene-4,7-dione.
| Compound Name | (3E)-3-hex-5-enylidene-5,6-dimethoxy-1,2-dihydroindene-4,7-dione |
|---|---|
| PubChem CID | 15004573 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (3E)-3-hex-5-enylidene-5,6-dimethoxy-1,2-dihydroindene-4,7-dione |
| SMILES | C=CCCC/C=C1\CCC2=C1C(=O)C(OC)=C(OC)C2=O |
| InChI | InChI=1S/C17H20O4/c1-4-5-6-7-8-11-9-10-12-13(11)15(19)17(21-3)16(20-2)14(12)18/h4,8H,1,5-7,9-10H2,2-3H3/b11-8+ |
| InChIKey | DIPFHRIPJPTGQE-DHZHZOJOSA-N |
| XLogP | 3.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|