C12H10N4O3S — CID 150051298
6-(4-methoxyphenyl)sulfonyl-7H-purine (PubChem CID 150051298) has the molecular formula C12H10N4O3S and a molecular weight of 290.30 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)sulfonyl-7H-purine.
| Compound Name | 6-(4-methoxyphenyl)sulfonyl-7H-purine |
|---|---|
| PubChem CID | 150051298 |
| Molecular Formula | C12H10N4O3S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 6-(4-methoxyphenyl)sulfonyl-7H-purine |
| SMILES | COc1ccc(S(=O)(=O)c2ncnc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C12H10N4O3S/c1-19-8-2-4-9(5-3-8)20(17,18)12-10-11(14-6-13-10)15-7-16-12/h2-7H,1H3,(H,13,14,15,16) |
| InChIKey | DLJOFAQKRGDLRO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |