C18H19N7 — CID 150054628
9-(2-methylpropyl)-8-pyrazol-1-yl-2-(pyridin-3-ylmethyl)purine (PubChem CID 150054628) has the molecular formula C18H19N7 and a molecular weight of 333.40 g/mol. Its IUPAC name is 9-(2-methylpropyl)-8-pyrazol-1-yl-2-(pyridin-3-ylmethyl)purine.
| Compound Name | 9-(2-methylpropyl)-8-pyrazol-1-yl-2-(pyridin-3-ylmethyl)purine |
|---|---|
| PubChem CID | 150054628 |
| Molecular Formula | C18H19N7 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 9-(2-methylpropyl)-8-pyrazol-1-yl-2-(pyridin-3-ylmethyl)purine |
| SMILES | CC(C)Cn1c(-n2cccn2)nc2cnc(Cc3cccnc3)nc21 |
| InChI | InChI=1S/C18H19N7/c1-13(2)12-24-17-15(22-18(24)25-8-4-7-21-25)11-20-16(23-17)9-14-5-3-6-19-10-14/h3-8,10-11,13H,9,12H2,1-2H3 |
| InChIKey | DMAHTKLMVUFLDJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |