C25H33N5O3 — CID 15005618
7-[4-(4-cycloheptylpiperazin-1-yl)-4-oxobutoxy]-1,3-dihydroimidazo[4,5-b]quinolin-2-one (PubChem CID 15005618) has the molecular formula C25H33N5O3 and a molecular weight of 451.57 g/mol. Its IUPAC name is 7-[4-(4-cycloheptylpiperazin-1-yl)-4-oxobutoxy]-1,3-dihydroimidazo[4,5-b]quinolin-2-one.
| Compound Name | 7-[4-(4-cycloheptylpiperazin-1-yl)-4-oxobutoxy]-1,3-dihydroimidazo[4,5-b]quinolin-2-one |
|---|---|
| PubChem CID | 15005618 |
| Molecular Formula | C25H33N5O3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | 7-[4-(4-cycloheptylpiperazin-1-yl)-4-oxobutoxy]-1,3-dihydroimidazo[4,5-b]quinolin-2-one |
| SMILES | O=C(CCCOc1ccc2nc3[nH]c(=O)[nH]c3cc2c1)N1CCN(C2CCCCCC2)CC1 |
| InChI | InChI=1S/C25H33N5O3/c31-23(30-13-11-29(12-14-30)19-6-3-1-2-4-7-19)8-5-15-33-20-9-10-21-18(16-20)17-22-24(26-21)28-25(32)27-22/h9-10,16-17,19H,1-8,11-15H2,(H2,26,27,28,32) |
| InChIKey | OKHOETHJEMLCNN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|