C11H10F3N3OS2 — CID 150060700
5-ethyl-3-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazol-5-yl]-1,2,4-oxadiazole (PubChem CID 150060700) has the molecular formula C11H10F3N3OS2 and a molecular weight of 321.35 g/mol. Its IUPAC name is 5-ethyl-3-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazol-5-yl]-1,2,4-oxadiazole.
| Compound Name | 5-ethyl-3-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazol-5-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 150060700 |
| Molecular Formula | C11H10F3N3OS2 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 5-ethyl-3-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazol-5-yl]-1,2,4-oxadiazole |
| SMILES | CCc1nc(-c2cnc(SCCC(F)=C(F)F)s2)no1 |
| InChI | InChI=1S/C11H10F3N3OS2/c1-2-8-16-10(17-18-8)7-5-15-11(20-7)19-4-3-6(12)9(13)14/h5H,2-4H2,1H3 |
| InChIKey | DNFTZXNJLPMZAC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|