C13H11N3OS — CID 67038628
5-ethyl-3-(4-phenyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole (PubChem CID 67038628) has the molecular formula C13H11N3OS and a molecular weight of 257.32 g/mol. Its IUPAC name is 5-ethyl-3-(4-phenyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole.
| Compound Name | 5-ethyl-3-(4-phenyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 67038628 |
| Molecular Formula | C13H11N3OS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 5-ethyl-3-(4-phenyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole |
| SMILES | CCc1nc(-c2scnc2-c2ccccc2)no1 |
| InChI | InChI=1S/C13H11N3OS/c1-2-10-15-13(16-17-10)12-11(14-8-18-12)9-6-4-3-5-7-9/h3-8H,2H2,1H3 |
| InChIKey | VLJCCDZUWHLWKY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |