C13H16N4O2 — CID 150064882
8,8-bis(cyclopropylmethyl)-3H-purine-2,6-dione (PubChem CID 150064882) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 8,8-bis(cyclopropylmethyl)-3H-purine-2,6-dione.
| Compound Name | 8,8-bis(cyclopropylmethyl)-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 150064882 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 8,8-bis(cyclopropylmethyl)-3H-purine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2c([nH]1)=NC(CC1CC1)(CC1CC1)N=2 |
| InChI | InChI=1S/C13H16N4O2/c18-11-9-10(14-12(19)15-11)17-13(16-9,5-7-1-2-7)6-8-3-4-8/h7-8H,1-6H2,(H2,14,15,17,18,19) |
| InChIKey | DOBLSSHCDHSFFH-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 90.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |