C13H20N4O2 — CID 151583212
8,8-bis(2-methylpropyl)-3H-purine-2,6-dione (PubChem CID 151583212) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 8,8-bis(2-methylpropyl)-3H-purine-2,6-dione.
| Compound Name | 8,8-bis(2-methylpropyl)-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 151583212 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 8,8-bis(2-methylpropyl)-3H-purine-2,6-dione |
| SMILES | CC(C)CC1(CC(C)C)N=c2[nH]c(=O)[nH]c(=O)c2=N1 |
| InChI | InChI=1S/C13H20N4O2/c1-7(2)5-13(6-8(3)4)16-9-10(17-13)14-12(19)15-11(9)18/h7-8H,5-6H2,1-4H3,(H2,14,15,17,18,19) |
| InChIKey | QGXYJXVHPKWACV-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 90.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |