About diphenylphosphane;1-naphthalen-1-yl-2H-naphthalen-2-ide;ruthenium(1+)
diphenylphosphane;1-naphthalen-1-yl-2H-naphthalen-2-ide;ruthenium(1+) (PubChem CID 150075579) has the molecular formula C32H24PRu
and a molecular weight of 540.59 g/mol. Its IUPAC name is diphenylphosphane;1-naphthalen-1-yl-2H-naphthalen-2-ide;ruthenium(1+).
Molecular Properties
| Compound Name | diphenylphosphane;1-naphthalen-1-yl-2H-naphthalen-2-ide;ruthenium(1+) |
| PubChem CID | 150075579 |
| Molecular Formula | C32H24PRu |
| Molecular Weight | 540.59 g/mol |
| Exact Mass | 541.07 |
| IUPAC Name | diphenylphosphane;1-naphthalen-1-yl-2H-naphthalen-2-ide;ruthenium(1+) |
| SMILES | [Ru+].[c-]1ccc2ccccc2c1-c1cccc2ccccc12.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C20H13.C12H11P.Ru/c1-3-11-17-15(7-1)9-5-13-19(17)20-14-6-10-16-8-2-4-12-18(16)20;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h1-13H;1-10,13H;/q-1;;+1 |
| InChIKey | XDYDVQGMSYWRKI-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 540.59 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphane;1-naphthalen-1-yl-2H-naphthalen-2-ide;ruthenium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphane;1-naphthalen-1-yl-2H-naphthalen-2-ide;ruthenium(1+)?
The IUPAC name of diphenylphosphane;1-naphthalen-1-yl-2H-naphthalen-2-ide;ruthenium(1+) (CID 150075579) is diphenylphosphane;1-naphthalen-1-yl-2H-naphthalen-2-ide;ruthenium(1+).
What is the SMILES notation for diphenylphosphane;1-naphthalen-1-yl-2H-naphthalen-2-ide;ruthenium(1+)?
The canonical SMILES for diphenylphosphane;1-naphthalen-1-yl-2H-naphthalen-2-ide;ruthenium(1+) is [Ru+].[c-]1ccc2ccccc2c1-c1cccc2ccccc12.c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of diphenylphosphane;1-naphthalen-1-yl-2H-naphthalen-2-ide;ruthenium(1+)?
The InChIKey is XDYDVQGMSYWRKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13.C12H11P.Ru/c1-3-11-17-15(7-1)9-5-13-19(17)20-14-6-10-16-8-2-4-12-18(16)20;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h1-13H;1-10,13H;/q-1;;+1.
What are the key properties of diphenylphosphane;1-naphthalen-1-yl-2H-naphthalen-2-ide;ruthenium(1+)?
diphenylphosphane;1-naphthalen-1-yl-2H-naphthalen-2-ide;ruthenium(1+) has a molecular weight of 540.59 g/mol, XLogP of 7.77, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphane;1-naphthalen-1-yl-2H-naphthalen-2-ide;ruthenium(1+) is sourced from PubChem (CID 150075579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).