C28H50N2O4 — CID 150076677
1-[(1R)-1-phenylethyl]-1-propyl-3-(10,10,10-triethoxydecyl)urea (PubChem CID 150076677) has the molecular formula C28H50N2O4 and a molecular weight of 478.72 g/mol. Its IUPAC name is 1-[(1R)-1-phenylethyl]-1-propyl-3-(10,10,10-triethoxydecyl)urea.
| Compound Name | 1-[(1R)-1-phenylethyl]-1-propyl-3-(10,10,10-triethoxydecyl)urea |
|---|---|
| PubChem CID | 150076677 |
| Molecular Formula | C28H50N2O4 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.38 |
| IUPAC Name | 1-[(1R)-1-phenylethyl]-1-propyl-3-(10,10,10-triethoxydecyl)urea |
| SMILES | CCCN(C(=O)NCCCCCCCCCC(OCC)(OCC)OCC)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C28H50N2O4/c1-6-24-30(25(5)26-20-16-15-17-21-26)27(31)29-23-19-14-12-10-11-13-18-22-28(32-7-2,33-8-3)34-9-4/h15-17,20-21,25H,6-14,18-19,22-24H2,1-5H3,(H,29,31)/t25-/m1/s1 |
| InChIKey | DQKJRTQQJKQLGT-RUZDIDTESA-N |
| XLogP | 7.05 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|