C14H10N2S2 — CID 150089442
2-(5-methyl-3-pyridinyl)isoindole-1,3-dithione (PubChem CID 150089442) has the molecular formula C14H10N2S2 and a molecular weight of 270.38 g/mol. Its IUPAC name is 2-(5-methyl-3-pyridinyl)isoindole-1,3-dithione.
| Compound Name | 2-(5-methyl-3-pyridinyl)isoindole-1,3-dithione |
|---|---|
| PubChem CID | 150089442 |
| Molecular Formula | C14H10N2S2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 2-(5-methyl-3-pyridinyl)isoindole-1,3-dithione |
| SMILES | Cc1cncc(N2C(=S)c3ccccc3C2=S)c1 |
| InChI | InChI=1S/C14H10N2S2/c1-9-6-10(8-15-7-9)16-13(17)11-4-2-3-5-12(11)14(16)18/h2-8H,1H3 |
| InChIKey | DSXMAPMFDWVJRI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|