C12H7F2N3 — CID 150099742
3-fluoro-2-(4-fluorophenyl)imidazo[1,2-a]pyrazine (PubChem CID 150099742) has the molecular formula C12H7F2N3 and a molecular weight of 231.21 g/mol. Its IUPAC name is 3-fluoro-2-(4-fluorophenyl)imidazo[1,2-a]pyrazine.
| Compound Name | 3-fluoro-2-(4-fluorophenyl)imidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 150099742 |
| Molecular Formula | C12H7F2N3 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 3-fluoro-2-(4-fluorophenyl)imidazo[1,2-a]pyrazine |
| SMILES | Fc1ccc(-c2nc3cnccn3c2F)cc1 |
| InChI | InChI=1S/C12H7F2N3/c13-9-3-1-8(2-4-9)11-12(14)17-6-5-15-7-10(17)16-11/h1-7H |
| InChIKey | DUZFUCGMTKTTDZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |