C21H17FN4O2 — CID 175772540
ethyl 4-[[2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]amino]benzoate (PubChem CID 175772540) has the molecular formula C21H17FN4O2 and a molecular weight of 376.39 g/mol. Its IUPAC name is ethyl 4-[[2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 175772540 |
| Molecular Formula | C21H17FN4O2 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | ethyl 4-[[2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2c(-c3ccc(F)cc3)nc3cnccn23)cc1 |
| InChI | InChI=1S/C21H17FN4O2/c1-2-28-21(27)15-5-9-17(10-6-15)24-20-19(14-3-7-16(22)8-4-14)25-18-13-23-11-12-26(18)20/h3-13,24H,2H2,1H3 |
| InChIKey | GIRMHAWCTWAECI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |