C23H20N4O4 — CID 53207832
methyl 4-[3-(4-ethoxycarbonylanilino)imidazo[1,2-a]pyrazin-2-yl]benzoate (PubChem CID 53207832) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is methyl 4-[3-(4-ethoxycarbonylanilino)imidazo[1,2-a]pyrazin-2-yl]benzoate.
| Compound Name | methyl 4-[3-(4-ethoxycarbonylanilino)imidazo[1,2-a]pyrazin-2-yl]benzoate |
|---|---|
| PubChem CID | 53207832 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | methyl 4-[3-(4-ethoxycarbonylanilino)imidazo[1,2-a]pyrazin-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2c(-c3ccc(C(=O)OC)cc3)nc3cnccn23)cc1 |
| InChI | InChI=1S/C23H20N4O4/c1-3-31-23(29)17-8-10-18(11-9-17)25-21-20(26-19-14-24-12-13-27(19)21)15-4-6-16(7-5-15)22(28)30-2/h4-14,25H,3H2,1-2H3 |
| InChIKey | NBURXLMHTGWCJE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |