C12H16F7NO — CID 150103018
(2S)-2-amino-1-cyclohexyl-4,4,5,5,6,6,6-heptafluorohexan-3-one (PubChem CID 150103018) has the molecular formula C12H16F7NO and a molecular weight of 323.25 g/mol. Its IUPAC name is (2S)-2-amino-1-cyclohexyl-4,4,5,5,6,6,6-heptafluorohexan-3-one.
| Compound Name | (2S)-2-amino-1-cyclohexyl-4,4,5,5,6,6,6-heptafluorohexan-3-one |
|---|---|
| PubChem CID | 150103018 |
| Molecular Formula | C12H16F7NO |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (2S)-2-amino-1-cyclohexyl-4,4,5,5,6,6,6-heptafluorohexan-3-one |
| SMILES | N[C@@H](CC1CCCCC1)C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H16F7NO/c13-10(14,11(15,16)12(17,18)19)9(21)8(20)6-7-4-2-1-3-5-7/h7-8H,1-6,20H2/t8-/m0/s1 |
| InChIKey | DVQQGKGGVZEMIB-QMMMGPOBSA-N |
| XLogP | 3.69 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|