C26H31F3N4O3 — CID 150104147
4-[6-(3-ethoxypropoxy)-3-pyridinyl]-2-[5-[(2-methylpropylamino)methyl]-2-(trifluoromethyl)phenyl]-1H-pyrimidin-6-one (PubChem CID 150104147) has the molecular formula C26H31F3N4O3 and a molecular weight of 504.55 g/mol. Its IUPAC name is 4-[6-(3-ethoxypropoxy)-3-pyridinyl]-2-[5-[(2-methylpropylamino)methyl]-2-(trifluoromethyl)phenyl]-1H-pyrimidin-6-one.
| Compound Name | 4-[6-(3-ethoxypropoxy)-3-pyridinyl]-2-[5-[(2-methylpropylamino)methyl]-2-(trifluoromethyl)phenyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 150104147 |
| Molecular Formula | C26H31F3N4O3 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | 4-[6-(3-ethoxypropoxy)-3-pyridinyl]-2-[5-[(2-methylpropylamino)methyl]-2-(trifluoromethyl)phenyl]-1H-pyrimidin-6-one |
| SMILES | CCOCCCOc1ccc(-c2cc(=O)[nH]c(-c3cc(CNCC(C)C)ccc3C(F)(F)F)n2)cn1 |
| InChI | InChI=1S/C26H31F3N4O3/c1-4-35-10-5-11-36-24-9-7-19(16-31-24)22-13-23(34)33-25(32-22)20-12-18(15-30-14-17(2)3)6-8-21(20)26(27,28)29/h6-9,12-13,16-17,30H,4-5,10-11,14-15H2,1-3H3,(H,32,33,34) |
| InChIKey | FZSCRUUCXTWRKN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|