C27H29F3N4O4 — CID 175210073
5-[3-[4-[6-(oxan-4-ylmethoxy)-3-pyridinyl]-6-oxo-1H-pyrimidin-2-yl]-4-(trifluoromethyl)phenyl]pentanamide (PubChem CID 175210073) has the molecular formula C27H29F3N4O4 and a molecular weight of 530.55 g/mol. Its IUPAC name is 5-[3-[4-[6-(oxan-4-ylmethoxy)-3-pyridinyl]-6-oxo-1H-pyrimidin-2-yl]-4-(trifluoromethyl)phenyl]pentanamide.
| Compound Name | 5-[3-[4-[6-(oxan-4-ylmethoxy)-3-pyridinyl]-6-oxo-1H-pyrimidin-2-yl]-4-(trifluoromethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 175210073 |
| Molecular Formula | C27H29F3N4O4 |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 5-[3-[4-[6-(oxan-4-ylmethoxy)-3-pyridinyl]-6-oxo-1H-pyrimidin-2-yl]-4-(trifluoromethyl)phenyl]pentanamide |
| SMILES | NC(=O)CCCCc1ccc(C(F)(F)F)c(-c2nc(-c3ccc(OCC4CCOCC4)nc3)cc(=O)[nH]2)c1 |
| InChI | InChI=1S/C27H29F3N4O4/c28-27(29,30)21-7-5-17(3-1-2-4-23(31)35)13-20(21)26-33-22(14-24(36)34-26)19-6-8-25(32-15-19)38-16-18-9-11-37-12-10-18/h5-8,13-15,18H,1-4,9-12,16H2,(H2,31,35)(H,33,34,36) |
| InChIKey | AUAJBTSPFKMAIC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|