C23H19F3N4O2 — CID 175369719
3-[3-[4-(5-ethynyl-3-pyridinyl)-6-oxo-1H-pyrimidin-2-yl]-4-(trifluoromethyl)phenyl]-2,2-dimethylpropanamide (PubChem CID 175369719) has the molecular formula C23H19F3N4O2 and a molecular weight of 440.43 g/mol. Its IUPAC name is 3-[3-[4-(5-ethynyl-3-pyridinyl)-6-oxo-1H-pyrimidin-2-yl]-4-(trifluoromethyl)phenyl]-2,2-dimethylpropanamide.
| Compound Name | 3-[3-[4-(5-ethynyl-3-pyridinyl)-6-oxo-1H-pyrimidin-2-yl]-4-(trifluoromethyl)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 175369719 |
| Molecular Formula | C23H19F3N4O2 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 3-[3-[4-(5-ethynyl-3-pyridinyl)-6-oxo-1H-pyrimidin-2-yl]-4-(trifluoromethyl)phenyl]-2,2-dimethylpropanamide |
| SMILES | C#Cc1cncc(-c2cc(=O)[nH]c(-c3cc(CC(C)(C)C(N)=O)ccc3C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C23H19F3N4O2/c1-4-13-7-15(12-28-11-13)18-9-19(31)30-20(29-18)16-8-14(10-22(2,3)21(27)32)5-6-17(16)23(24,25)26/h1,5-9,11-12H,10H2,2-3H3,(H2,27,32)(H,29,30,31) |
| InChIKey | LGXNLDMYWGNPQS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|