C21H19ClF2N4O3 — CID 175208680
5-[4-chloro-3-[4-[6-(difluoromethoxy)-3-pyridinyl]-6-oxo-1H-pyrimidin-2-yl]phenyl]pentanamide (PubChem CID 175208680) has the molecular formula C21H19ClF2N4O3 and a molecular weight of 448.86 g/mol. Its IUPAC name is 5-[4-chloro-3-[4-[6-(difluoromethoxy)-3-pyridinyl]-6-oxo-1H-pyrimidin-2-yl]phenyl]pentanamide.
| Compound Name | 5-[4-chloro-3-[4-[6-(difluoromethoxy)-3-pyridinyl]-6-oxo-1H-pyrimidin-2-yl]phenyl]pentanamide |
|---|---|
| PubChem CID | 175208680 |
| Molecular Formula | C21H19ClF2N4O3 |
| Molecular Weight | 448.86 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 5-[4-chloro-3-[4-[6-(difluoromethoxy)-3-pyridinyl]-6-oxo-1H-pyrimidin-2-yl]phenyl]pentanamide |
| SMILES | NC(=O)CCCCc1ccc(Cl)c(-c2nc(-c3ccc(OC(F)F)nc3)cc(=O)[nH]2)c1 |
| InChI | InChI=1S/C21H19ClF2N4O3/c22-15-7-5-12(3-1-2-4-17(25)29)9-14(15)20-27-16(10-18(30)28-20)13-6-8-19(26-11-13)31-21(23)24/h5-11,21H,1-4H2,(H2,25,29)(H,27,28,30) |
| InChIKey | BHIRQDVLQULKIZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.86 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|