C40H74O6 — CID 150108305
1,2-bis(13,13,13-trimethoxy-3-methyltridecan-3-yl)benzene (PubChem CID 150108305) has the molecular formula C40H74O6 and a molecular weight of 651.03 g/mol. Its IUPAC name is 1,2-bis(13,13,13-trimethoxy-3-methyltridecan-3-yl)benzene.
| Compound Name | 1,2-bis(13,13,13-trimethoxy-3-methyltridecan-3-yl)benzene |
|---|---|
| PubChem CID | 150108305 |
| Molecular Formula | C40H74O6 |
| Molecular Weight | 651.03 g/mol |
| Exact Mass | 650.55 |
| IUPAC Name | 1,2-bis(13,13,13-trimethoxy-3-methyltridecan-3-yl)benzene |
| SMILES | CCC(C)(CCCCCCCCCC(OC)(OC)OC)c1ccccc1C(C)(CC)CCCCCCCCCC(OC)(OC)OC |
| InChI | InChI=1S/C40H74O6/c1-11-37(3,31-25-19-15-13-17-21-27-33-39(41-5,42-6)43-7)35-29-23-24-30-36(35)38(4,12-2)32-26-20-16-14-18-22-28-34-40(44-8,45-9)46-10/h23-24,29-30H,11-22,25-28,31-34H2,1-10H3 |
| InChIKey | DWSFBSDSHWSCNH-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.03 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|