C18H15N5O4 — CID 15011134
6,12-dimethyl-2-(4-methylphenyl)-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1(10),3,8-triene-5,7,11,13-tetrone (PubChem CID 15011134) has the molecular formula C18H15N5O4 and a molecular weight of 365.35 g/mol. Its IUPAC name is 6,12-dimethyl-2-(4-methylphenyl)-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1(10),3,8-triene-5,7,11,13-tetrone.
| Compound Name | 6,12-dimethyl-2-(4-methylphenyl)-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1(10),3,8-triene-5,7,11,13-tetrone |
|---|---|
| PubChem CID | 15011134 |
| Molecular Formula | C18H15N5O4 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 6,12-dimethyl-2-(4-methylphenyl)-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1(10),3,8-triene-5,7,11,13-tetrone |
| SMILES | Cc1ccc(-n2c3nc(=O)n(C)c(=O)c-3cc3c(=O)n(C)c(=O)[nH]c32)cc1 |
| InChI | InChI=1S/C18H15N5O4/c1-9-4-6-10(7-5-9)23-13-11(15(24)21(2)17(26)19-13)8-12-14(23)20-18(27)22(3)16(12)25/h4-8H,1-3H3,(H,19,26) |
| InChIKey | KWKSTLZNUXNODP-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|