C11H18O — CID 15011477
(3R,4S)-4-(2-methylprop-2-enyl)-1-oxaspiro[2.5]octane (PubChem CID 15011477) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (3R,4S)-4-(2-methylprop-2-enyl)-1-oxaspiro[2.5]octane.
| Compound Name | (3R,4S)-4-(2-methylprop-2-enyl)-1-oxaspiro[2.5]octane |
|---|---|
| PubChem CID | 15011477 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (3R,4S)-4-(2-methylprop-2-enyl)-1-oxaspiro[2.5]octane |
| SMILES | C=C(C)C[C@@H]1CCCC[C@]12CO2 |
| InChI | InChI=1S/C11H18O/c1-9(2)7-10-5-3-4-6-11(10)8-12-11/h10H,1,3-8H2,2H3/t10-,11-/m0/s1 |
| InChIKey | CAXMLOLOBKFJDA-QWRGUYRKSA-N |
| XLogP | 2.91 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|