C13H20O — CID 23522985
(3R,4S)-4-(cyclohexen-1-yl)-1-oxaspiro[2.5]octane (PubChem CID 23522985) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (3R,4S)-4-(cyclohexen-1-yl)-1-oxaspiro[2.5]octane.
| Compound Name | (3R,4S)-4-(cyclohexen-1-yl)-1-oxaspiro[2.5]octane |
|---|---|
| PubChem CID | 23522985 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (3R,4S)-4-(cyclohexen-1-yl)-1-oxaspiro[2.5]octane |
| SMILES | C1=C([C@@H]2CCCC[C@]23CO3)CCCC1 |
| InChI | InChI=1S/C13H20O/c1-2-6-11(7-3-1)12-8-4-5-9-13(12)10-14-13/h6,12H,1-5,7-10H2/t12-,13-/m0/s1 |
| InChIKey | VBIZKBGJFYFQFS-STQMWFEESA-N |
| XLogP | 3.45 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|