C9H13F6NO — CID 150129717
2-methyl-3,3-bis(2,2,2-trifluoroethyl)morpholine (PubChem CID 150129717) has the molecular formula C9H13F6NO and a molecular weight of 265.20 g/mol. Its IUPAC name is 2-methyl-3,3-bis(2,2,2-trifluoroethyl)morpholine.
| Compound Name | 2-methyl-3,3-bis(2,2,2-trifluoroethyl)morpholine |
|---|---|
| PubChem CID | 150129717 |
| Molecular Formula | C9H13F6NO |
| Molecular Weight | 265.20 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-methyl-3,3-bis(2,2,2-trifluoroethyl)morpholine |
| SMILES | CC1OCCNC1(CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C9H13F6NO/c1-6-7(4-8(10,11)12,5-9(13,14)15)16-2-3-17-6/h6,16H,2-5H2,1H3 |
| InChIKey | VLBUHIYIYMSPNM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.20 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |