C16H18N2O6S2 — CID 150134093
4-[[4-(methanesulfonamido)phenyl]methyl-methylsulfonylamino]benzoic acid (PubChem CID 150134093) has the molecular formula C16H18N2O6S2 and a molecular weight of 398.46 g/mol. Its IUPAC name is 4-[[4-(methanesulfonamido)phenyl]methyl-methylsulfonylamino]benzoic acid.
| Compound Name | 4-[[4-(methanesulfonamido)phenyl]methyl-methylsulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 150134093 |
| Molecular Formula | C16H18N2O6S2 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 4-[[4-(methanesulfonamido)phenyl]methyl-methylsulfonylamino]benzoic acid |
| SMILES | CS(=O)(=O)Nc1ccc(CN(c2ccc(C(=O)O)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H18N2O6S2/c1-25(21,22)17-14-7-3-12(4-8-14)11-18(26(2,23)24)15-9-5-13(6-10-15)16(19)20/h3-10,17H,11H2,1-2H3,(H,19,20) |
| InChIKey | FBWGVNLKGYHKAU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |