C28H26N2O3S2 — CID 28589827
4-[benzyl(methylsulfonyl)amino]-N-[4-(phenylsulfanylmethyl)phenyl]benzamide (PubChem CID 28589827) has the molecular formula C28H26N2O3S2 and a molecular weight of 502.66 g/mol. Its IUPAC name is 4-[benzyl(methylsulfonyl)amino]-N-[4-(phenylsulfanylmethyl)phenyl]benzamide.
| Compound Name | 4-[benzyl(methylsulfonyl)amino]-N-[4-(phenylsulfanylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 28589827 |
| Molecular Formula | C28H26N2O3S2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 4-[benzyl(methylsulfonyl)amino]-N-[4-(phenylsulfanylmethyl)phenyl]benzamide |
| SMILES | CS(=O)(=O)N(Cc1ccccc1)c1ccc(C(=O)Nc2ccc(CSc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H26N2O3S2/c1-35(32,33)30(20-22-8-4-2-5-9-22)26-18-14-24(15-19-26)28(31)29-25-16-12-23(13-17-25)21-34-27-10-6-3-7-11-27/h2-19H,20-21H2,1H3,(H,29,31) |
| InChIKey | RVMLPUFDAMAMML-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |