C25H29N3O5S2 — CID 1295864
N-[4-(diethylsulfamoyl)phenyl]-4-[(N-methylsulfonylanilino)methyl]benzamide (PubChem CID 1295864) has the molecular formula C25H29N3O5S2 and a molecular weight of 515.66 g/mol. Its IUPAC name is N-[4-(diethylsulfamoyl)phenyl]-4-[(N-methylsulfonylanilino)methyl]benzamide.
| Compound Name | N-[4-(diethylsulfamoyl)phenyl]-4-[(N-methylsulfonylanilino)methyl]benzamide |
|---|---|
| PubChem CID | 1295864 |
| Molecular Formula | C25H29N3O5S2 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | N-[4-(diethylsulfamoyl)phenyl]-4-[(N-methylsulfonylanilino)methyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)c2ccc(CN(c3ccccc3)S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C25H29N3O5S2/c1-4-27(5-2)35(32,33)24-17-15-22(16-18-24)26-25(29)21-13-11-20(12-14-21)19-28(34(3,30)31)23-9-7-6-8-10-23/h6-18H,4-5,19H2,1-3H3,(H,26,29) |
| InChIKey | FFEFJHJYSWYZTR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |