C29H28ClNO5 — CID 15015298
2-[2-chloro-6-[[4-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]-4-methylpentanoic acid (PubChem CID 15015298) has the molecular formula C29H28ClNO5 and a molecular weight of 506.00 g/mol. Its IUPAC name is 2-[2-chloro-6-[[4-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]-4-methylpentanoic acid.
| Compound Name | 2-[2-chloro-6-[[4-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 15015298 |
| Molecular Formula | C29H28ClNO5 |
| Molecular Weight | 506.00 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 2-[2-chloro-6-[[4-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]-4-methylpentanoic acid |
| SMILES | CC(C)CC(Oc1c(Cl)cccc1COc1ccc(OCc2ccc3ccccc3n2)cc1)C(=O)O |
| InChI | InChI=1S/C29H28ClNO5/c1-19(2)16-27(29(32)33)36-28-21(7-5-8-25(28)30)17-34-23-12-14-24(15-13-23)35-18-22-11-10-20-6-3-4-9-26(20)31-22/h3-15,19,27H,16-18H2,1-2H3,(H,32,33) |
| InChIKey | XTJCZDJWQDRBBT-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.00 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |