C29H28FNO5 — CID 18727380
2-[2-[[4-[(8-fluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]pentanoic acid (PubChem CID 18727380) has the molecular formula C29H28FNO5 and a molecular weight of 489.54 g/mol. Its IUPAC name is 2-[2-[[4-[(8-fluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]pentanoic acid.
| Compound Name | 2-[2-[[4-[(8-fluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]pentanoic acid |
|---|---|
| PubChem CID | 18727380 |
| Molecular Formula | C29H28FNO5 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 2-[2-[[4-[(8-fluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]pentanoic acid |
| SMILES | CCCC(Oc1c(C)cccc1COc1ccc(OCc2ccc3cccc(F)c3n2)cc1)C(=O)O |
| InChI | InChI=1S/C29H28FNO5/c1-3-6-26(29(32)33)36-28-19(2)7-4-9-21(28)17-34-23-13-15-24(16-14-23)35-18-22-12-11-20-8-5-10-25(30)27(20)31-22/h4-5,7-16,26H,3,6,17-18H2,1-2H3,(H,32,33) |
| InChIKey | CBKZDZJKBZTQBR-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |