C16H17NO3 — CID 150157753
2-(3-methoxyphenyl)-4a,5,6,7-tetrahydro-4H-isoquinoline-1,3-dione (PubChem CID 150157753) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-4a,5,6,7-tetrahydro-4H-isoquinoline-1,3-dione.
| Compound Name | 2-(3-methoxyphenyl)-4a,5,6,7-tetrahydro-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 150157753 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-(3-methoxyphenyl)-4a,5,6,7-tetrahydro-4H-isoquinoline-1,3-dione |
| SMILES | COc1cccc(N2C(=O)CC3CCCC=C3C2=O)c1 |
| InChI | InChI=1S/C16H17NO3/c1-20-13-7-4-6-12(10-13)17-15(18)9-11-5-2-3-8-14(11)16(17)19/h4,6-8,10-11H,2-3,5,9H2,1H3 |
| InChIKey | FGPHQGFPYHOCMO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|