C17H17NO2 — CID 150157788
1-[4-(aminomethyl)phenyl]-2-methyl-3-phenylpropane-1,3-dione (PubChem CID 150157788) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 1-[4-(aminomethyl)phenyl]-2-methyl-3-phenylpropane-1,3-dione.
| Compound Name | 1-[4-(aminomethyl)phenyl]-2-methyl-3-phenylpropane-1,3-dione |
|---|---|
| PubChem CID | 150157788 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 1-[4-(aminomethyl)phenyl]-2-methyl-3-phenylpropane-1,3-dione |
| SMILES | CC(C(=O)c1ccccc1)C(=O)c1ccc(CN)cc1 |
| InChI | InChI=1S/C17H17NO2/c1-12(16(19)14-5-3-2-4-6-14)17(20)15-9-7-13(11-18)8-10-15/h2-10,12H,11,18H2,1H3 |
| InChIKey | FGPKWZMJIODRCC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|