C23H27ClN4O5 — CID 150160816
butyl 2-[4-[5-chloro-2-(1,2,4-triazol-4-yl)phenyl]-5-methoxy-2-oxo-1-pyridinyl]-4-methoxybutanoate (PubChem CID 150160816) has the molecular formula C23H27ClN4O5 and a molecular weight of 474.95 g/mol. Its IUPAC name is butyl 2-[4-[5-chloro-2-(1,2,4-triazol-4-yl)phenyl]-5-methoxy-2-oxo-1-pyridinyl]-4-methoxybutanoate.
| Compound Name | butyl 2-[4-[5-chloro-2-(1,2,4-triazol-4-yl)phenyl]-5-methoxy-2-oxo-1-pyridinyl]-4-methoxybutanoate |
|---|---|
| PubChem CID | 150160816 |
| Molecular Formula | C23H27ClN4O5 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | butyl 2-[4-[5-chloro-2-(1,2,4-triazol-4-yl)phenyl]-5-methoxy-2-oxo-1-pyridinyl]-4-methoxybutanoate |
| SMILES | CCCCOC(=O)C(CCOC)n1cc(OC)c(-c2cc(Cl)ccc2-n2cnnc2)cc1=O |
| InChI | InChI=1S/C23H27ClN4O5/c1-4-5-9-33-23(30)20(8-10-31-2)28-13-21(32-3)18(12-22(28)29)17-11-16(24)6-7-19(17)27-14-25-26-15-27/h6-7,11-15,20H,4-5,8-10H2,1-3H3 |
| InChIKey | FHJSIXYNYHEMBA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 97.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|