C18H22ClNO3 — CID 166879599
4-(5-chloro-2-methylphenyl)-5-methoxy-1-(4-methoxybutan-2-yl)pyridin-2-one (PubChem CID 166879599) has the molecular formula C18H22ClNO3 and a molecular weight of 335.83 g/mol. Its IUPAC name is 4-(5-chloro-2-methylphenyl)-5-methoxy-1-(4-methoxybutan-2-yl)pyridin-2-one.
| Compound Name | 4-(5-chloro-2-methylphenyl)-5-methoxy-1-(4-methoxybutan-2-yl)pyridin-2-one |
|---|---|
| PubChem CID | 166879599 |
| Molecular Formula | C18H22ClNO3 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 4-(5-chloro-2-methylphenyl)-5-methoxy-1-(4-methoxybutan-2-yl)pyridin-2-one |
| SMILES | COCCC(C)n1cc(OC)c(-c2cc(Cl)ccc2C)cc1=O |
| InChI | InChI=1S/C18H22ClNO3/c1-12-5-6-14(19)9-15(12)16-10-18(21)20(11-17(16)23-4)13(2)7-8-22-3/h5-6,9-11,13H,7-8H2,1-4H3 |
| InChIKey | QLLPHOXVTWBEHP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |