C22H23ClNO2P — CID 138655957
4-(5-chloro-2-methylphenyl)-5-methoxy-1-[1-(2-phosphanylphenyl)propan-2-yl]pyridin-2-one (PubChem CID 138655957) has the molecular formula C22H23ClNO2P and a molecular weight of 399.86 g/mol. Its IUPAC name is 4-(5-chloro-2-methylphenyl)-5-methoxy-1-[1-(2-phosphanylphenyl)propan-2-yl]pyridin-2-one.
| Compound Name | 4-(5-chloro-2-methylphenyl)-5-methoxy-1-[1-(2-phosphanylphenyl)propan-2-yl]pyridin-2-one |
|---|---|
| PubChem CID | 138655957 |
| Molecular Formula | C22H23ClNO2P |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 4-(5-chloro-2-methylphenyl)-5-methoxy-1-[1-(2-phosphanylphenyl)propan-2-yl]pyridin-2-one |
| SMILES | COc1cn(C(C)Cc2ccccc2P)c(=O)cc1-c1cc(Cl)ccc1C |
| InChI | InChI=1S/C22H23ClNO2P/c1-14-8-9-17(23)11-18(14)19-12-22(25)24(13-20(19)26-3)15(2)10-16-6-4-5-7-21(16)27/h4-9,11-13,15H,10,27H2,1-3H3 |
| InChIKey | LITYQIHLUYAANE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|