C11H18O5 — CID 150161770
3-(prop-1-enoxymethyl)-1,5,7,11-tetraoxaspiro[5.5]undecane (PubChem CID 150161770) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is 3-(prop-1-enoxymethyl)-1,5,7,11-tetraoxaspiro[5.5]undecane.
| Compound Name | 3-(prop-1-enoxymethyl)-1,5,7,11-tetraoxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 150161770 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 3-(prop-1-enoxymethyl)-1,5,7,11-tetraoxaspiro[5.5]undecane |
| SMILES | CC=COCC1COC2(OCCCO2)OC1 |
| InChI | InChI=1S/C11H18O5/c1-2-4-12-7-10-8-15-11(16-9-10)13-5-3-6-14-11/h2,4,10H,3,5-9H2,1H3 |
| InChIKey | FHOYVAMPJPTQMS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|