C24H19ClF7NO2 — CID 150168888
methyl 2-chloro-5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,6-trimethylphenyl]pyrrol-3-yl]benzoate (PubChem CID 150168888) has the molecular formula C24H19ClF7NO2 and a molecular weight of 521.86 g/mol. Its IUPAC name is methyl 2-chloro-5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,6-trimethylphenyl]pyrrol-3-yl]benzoate.
| Compound Name | methyl 2-chloro-5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,6-trimethylphenyl]pyrrol-3-yl]benzoate |
|---|---|
| PubChem CID | 150168888 |
| Molecular Formula | C24H19ClF7NO2 |
| Molecular Weight | 521.86 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | methyl 2-chloro-5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,6-trimethylphenyl]pyrrol-3-yl]benzoate |
| SMILES | COC(=O)c1cc(-c2ccn(-c3c(C)cc(C(F)(C(F)(F)F)C(F)(F)F)c(C)c3C)c2)ccc1Cl |
| InChI | InChI=1S/C24H19ClF7NO2/c1-12-9-18(22(26,23(27,28)29)24(30,31)32)13(2)14(3)20(12)33-8-7-16(11-33)15-5-6-19(25)17(10-15)21(34)35-4/h5-11H,1-4H3 |
| InChIKey | FIZSNBYPPNXDBY-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.86 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |