C22H40O2 — CID 150173823
2,3-bis(ethenyl)-2-tetradecyl-1,4-dioxane (PubChem CID 150173823) has the molecular formula C22H40O2 and a molecular weight of 336.56 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-2-tetradecyl-1,4-dioxane.
| Compound Name | 2,3-bis(ethenyl)-2-tetradecyl-1,4-dioxane |
|---|---|
| PubChem CID | 150173823 |
| Molecular Formula | C22H40O2 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.30 |
| IUPAC Name | 2,3-bis(ethenyl)-2-tetradecyl-1,4-dioxane |
| SMILES | C=CC1OCCOC1(C=C)CCCCCCCCCCCCCC |
| InChI | InChI=1S/C22H40O2/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-22(6-3)21(5-2)23-19-20-24-22/h5-6,21H,2-4,7-20H2,1H3 |
| InChIKey | FJZJHAAVPYDBCY-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|