C20H13F3N2OS — CID 150179705
2-[[3-thiophen-2-yl-2-(trifluoromethyl)phenyl]methyl]indazole-5-carbaldehyde (PubChem CID 150179705) has the molecular formula C20H13F3N2OS and a molecular weight of 386.40 g/mol. Its IUPAC name is 2-[[3-thiophen-2-yl-2-(trifluoromethyl)phenyl]methyl]indazole-5-carbaldehyde.
| Compound Name | 2-[[3-thiophen-2-yl-2-(trifluoromethyl)phenyl]methyl]indazole-5-carbaldehyde |
|---|---|
| PubChem CID | 150179705 |
| Molecular Formula | C20H13F3N2OS |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 2-[[3-thiophen-2-yl-2-(trifluoromethyl)phenyl]methyl]indazole-5-carbaldehyde |
| SMILES | O=Cc1ccc2nn(Cc3cccc(-c4cccs4)c3C(F)(F)F)cc2c1 |
| InChI | InChI=1S/C20H13F3N2OS/c21-20(22,23)19-14(3-1-4-16(19)18-5-2-8-27-18)10-25-11-15-9-13(12-26)6-7-17(15)24-25/h1-9,11-12H,10H2 |
| InChIKey | FLDRKTFJFRUHOY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|