C29H29N3O2 — CID 150182067
3-(dimethylamino)-N-[3-[[(4-hydroxyphenyl)-phenylmethyl]amino]-4-methylphenyl]benzamide (PubChem CID 150182067) has the molecular formula C29H29N3O2 and a molecular weight of 451.57 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[3-[[(4-hydroxyphenyl)-phenylmethyl]amino]-4-methylphenyl]benzamide.
| Compound Name | 3-(dimethylamino)-N-[3-[[(4-hydroxyphenyl)-phenylmethyl]amino]-4-methylphenyl]benzamide |
|---|---|
| PubChem CID | 150182067 |
| Molecular Formula | C29H29N3O2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 3-(dimethylamino)-N-[3-[[(4-hydroxyphenyl)-phenylmethyl]amino]-4-methylphenyl]benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(N(C)C)c2)cc1NC(c1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C29H29N3O2/c1-20-12-15-24(30-29(34)23-10-7-11-25(18-23)32(2)3)19-27(20)31-28(21-8-5-4-6-9-21)22-13-16-26(33)17-14-22/h4-19,28,31,33H,1-3H3,(H,30,34) |
| InChIKey | FLQIXYARCLXQTM-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |