C20H25ClN4O4S2 — CID 150190546
1'-acetyl-1-(5-chloro-1,3-thiazol-2-yl)-N-(3-methoxypropyl)spiro[2H-indole-3,3'-pyrrolidine]-5-sulfonamide (PubChem CID 150190546) has the molecular formula C20H25ClN4O4S2 and a molecular weight of 485.03 g/mol. Its IUPAC name is 1'-acetyl-1-(5-chloro-1,3-thiazol-2-yl)-N-(3-methoxypropyl)spiro[2H-indole-3,3'-pyrrolidine]-5-sulfonamide.
| Compound Name | 1'-acetyl-1-(5-chloro-1,3-thiazol-2-yl)-N-(3-methoxypropyl)spiro[2H-indole-3,3'-pyrrolidine]-5-sulfonamide |
|---|---|
| PubChem CID | 150190546 |
| Molecular Formula | C20H25ClN4O4S2 |
| Molecular Weight | 485.03 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 1'-acetyl-1-(5-chloro-1,3-thiazol-2-yl)-N-(3-methoxypropyl)spiro[2H-indole-3,3'-pyrrolidine]-5-sulfonamide |
| SMILES | COCCCNS(=O)(=O)c1ccc2c(c1)C1(CCN(C(C)=O)C1)CN2c1ncc(Cl)s1 |
| InChI | InChI=1S/C20H25ClN4O4S2/c1-14(26)24-8-6-20(12-24)13-25(19-22-11-18(21)30-19)17-5-4-15(10-16(17)20)31(27,28)23-7-3-9-29-2/h4-5,10-11,23H,3,6-9,12-13H2,1-2H3 |
| InChIKey | FNIOXDHBOHCUQB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.03 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|