C12H21N3O3 — CID 150204352
3-[3,5-bis(3-oxopropyl)-1,3,5-triazinan-1-yl]propanal (PubChem CID 150204352) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-[3,5-bis(3-oxopropyl)-1,3,5-triazinan-1-yl]propanal.
| Compound Name | 3-[3,5-bis(3-oxopropyl)-1,3,5-triazinan-1-yl]propanal |
|---|---|
| PubChem CID | 150204352 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 3-[3,5-bis(3-oxopropyl)-1,3,5-triazinan-1-yl]propanal |
| SMILES | O=CCCN1CN(CCC=O)CN(CCC=O)C1 |
| InChI | InChI=1S/C12H21N3O3/c16-7-1-4-13-10-14(5-2-8-17)12-15(11-13)6-3-9-18/h7-9H,1-6,10-12H2 |
| InChIKey | FQDVQFIFNJNILT-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|