About 3-[3,5-bis(3-oxopropyl)-1,3,5-triazinan-1-yl]propanal
3-[3,5-bis(3-oxopropyl)-1,3,5-triazinan-1-yl]propanal (PubChem CID 150204352) has the molecular formula C12H21N3O3
and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-[3,5-bis(3-oxopropyl)-1,3,5-triazinan-1-yl]propanal.
Molecular Properties
| Compound Name | 3-[3,5-bis(3-oxopropyl)-1,3,5-triazinan-1-yl]propanal |
| PubChem CID | 150204352 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 3-[3,5-bis(3-oxopropyl)-1,3,5-triazinan-1-yl]propanal |
| SMILES | O=CCCN1CN(CCC=O)CN(CCC=O)C1 |
| InChI | InChI=1S/C12H21N3O3/c16-7-1-4-13-10-14(5-2-8-17)12-15(11-13)6-3-9-18/h7-9H,1-6,10-12H2 |
| InChIKey | FQDVQFIFNJNILT-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[3,5-bis(3-oxopropyl)-1,3,5-triazinan-1-yl]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-bis(3-oxopropyl)-1,3,5-triazinan-1-yl]propanal?
The IUPAC name of 3-[3,5-bis(3-oxopropyl)-1,3,5-triazinan-1-yl]propanal (CID 150204352) is 3-[3,5-bis(3-oxopropyl)-1,3,5-triazinan-1-yl]propanal.
What is the SMILES notation for 3-[3,5-bis(3-oxopropyl)-1,3,5-triazinan-1-yl]propanal?
The canonical SMILES for 3-[3,5-bis(3-oxopropyl)-1,3,5-triazinan-1-yl]propanal is O=CCCN1CN(CCC=O)CN(CCC=O)C1.
What is the InChIKey of 3-[3,5-bis(3-oxopropyl)-1,3,5-triazinan-1-yl]propanal?
The InChIKey is FQDVQFIFNJNILT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O3/c16-7-1-4-13-10-14(5-2-8-17)12-15(11-13)6-3-9-18/h7-9H,1-6,10-12H2.
What are the key properties of 3-[3,5-bis(3-oxopropyl)-1,3,5-triazinan-1-yl]propanal?
3-[3,5-bis(3-oxopropyl)-1,3,5-triazinan-1-yl]propanal has a molecular weight of 255.32 g/mol, XLogP of -0.45, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-bis(3-oxopropyl)-1,3,5-triazinan-1-yl]propanal is sourced from PubChem (CID 150204352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).