C15H24O2 — CID 150206166
1-(1-methoxycyclopenta-2,4-dien-1-yl)-7-methyloctan-1-one (PubChem CID 150206166) has the molecular formula C15H24O2 and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-(1-methoxycyclopenta-2,4-dien-1-yl)-7-methyloctan-1-one.
| Compound Name | 1-(1-methoxycyclopenta-2,4-dien-1-yl)-7-methyloctan-1-one |
|---|---|
| PubChem CID | 150206166 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 1-(1-methoxycyclopenta-2,4-dien-1-yl)-7-methyloctan-1-one |
| SMILES | COC1(C(=O)CCCCCC(C)C)C=CC=C1 |
| InChI | InChI=1S/C15H24O2/c1-13(2)9-5-4-6-10-14(16)15(17-3)11-7-8-12-15/h7-8,11-13H,4-6,9-10H2,1-3H3 |
| InChIKey | FQNLVMIVDDPBLQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|