C17H28O2 — CID 67420374
1-cyclopenta-2,4-dien-1-yl-1-methoxyundecan-2-one (PubChem CID 67420374) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-yl-1-methoxyundecan-2-one.
| Compound Name | 1-cyclopenta-2,4-dien-1-yl-1-methoxyundecan-2-one |
|---|---|
| PubChem CID | 67420374 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-yl-1-methoxyundecan-2-one |
| SMILES | CCCCCCCCCC(=O)C(OC)C1C=CC=C1 |
| InChI | InChI=1S/C17H28O2/c1-3-4-5-6-7-8-9-14-16(18)17(19-2)15-12-10-11-13-15/h10-13,15,17H,3-9,14H2,1-2H3 |
| InChIKey | SODNPNZEQKDUJZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|