C13H21F2NO2 — CID 15021210
tert-butyl N-[(2E)-5,5-difluoroocta-2,7-dien-4-yl]carbamate (PubChem CID 15021210) has the molecular formula C13H21F2NO2 and a molecular weight of 261.31 g/mol. Its IUPAC name is tert-butyl N-[(2E)-5,5-difluoroocta-2,7-dien-4-yl]carbamate.
| Compound Name | tert-butyl N-[(2E)-5,5-difluoroocta-2,7-dien-4-yl]carbamate |
|---|---|
| PubChem CID | 15021210 |
| Molecular Formula | C13H21F2NO2 |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | tert-butyl N-[(2E)-5,5-difluoroocta-2,7-dien-4-yl]carbamate |
| SMILES | C=CCC(F)(F)C(/C=C/C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H21F2NO2/c1-6-8-10(13(14,15)9-7-2)16-11(17)18-12(3,4)5/h6-8,10H,2,9H2,1,3-5H3,(H,16,17)/b8-6+ |
| InChIKey | ZEGKGFDOMULFDC-SOFGYWHQSA-N |
| XLogP | 3.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|